| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
BET-IN-4 manufacturers
- ODM-207
-
- $39.00
-
2026-07-14
- CAS:1801503-93-4
- Purity: 99.75%
- Supply Ability: 10g
- ODM-207
-
- $39.00
-
2026-07-14
- CAS:1801503-93-4
- Purity: 99.75%
- Supply Ability: 10g
|
| | BET-IN-4 Basic information |
| Product Name: | BET-IN-4 | | Synonyms: | BET-IN-4;2(1H)-Quinolinone, 6-(3,5-dimethyl-4-isoxazolyl)-7-methoxy-3-methyl-1-(2-pyridinylmethyl)-;ODM-207，BET-IN-4;Epigenetic Reader Domain,inhibit,ODM-207,Inhibitor,ODM 207;ODM-207, 10 mM in DMSO;ODM-207 | | CAS: | 1801503-93-4 | | MF: | C22H21N3O3 | | MW: | 375.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1801503-93-4.mol |  |
| | BET-IN-4 Chemical Properties |
| Boiling point | 529.0±50.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 10 mg/mL (26.64 mM; ultrasonic and warming and heat to 60°C) | | pka | 4.36±0.12(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C22H21N3O3/c1-13-9-16-10-18(21-14(2)24-28-15(21)3)20(27-4)11-19(16)25(22(13)26)12-17-7-5-6-8-23-17/h5-11H,12H2,1-4H3 | | InChIKey | YVGWSVHZXWFLIT-UHFFFAOYSA-N | | SMILES | N1(CC2=NC=CC=C2)C2=C(C=C(C3=C(C)ON=C3C)C(OC)=C2)C=C(C)C1=O |
| | BET-IN-4 Usage And Synthesis |
| Uses | ODM-207 (BET-IN-4) is a potent BET bromodomain protein (BRD4) inhibitor, with an IC50 of ≤ 1 μM[1]. | | IC 50 | BRD4: ≤ 1 μM (IC50) | | References | [1] Susanta Samajdar, et al. Bicyclic heterocyclic derivatives as bromodomain inhibitors. WO2015104653A1 |
| | BET-IN-4 Preparation Products And Raw materials |
|