|
|
| | Paeoniflorin sulfite Basic information |
| Product Name: | Paeoniflorin sulfite | | Synonyms: | Paeoniflorin sulfite;β-D-Glucopyranoside, (1aR,2S,3aR,5S,5aR,5bS)-5b-[(benzoyloxy)methyl]tetrahydro-2-methyl-5-(sulfinooxy)-2,5-methano-1H-3,4-dioxacyclobuta[cd]pentalen-1a(2H)-yl | | CAS: | 1146967-98-7 | | MF: | C23H28O13S | | MW: | 544.53 | | EINECS: | | | Product Categories: | | | Mol File: | 1146967-98-7.mol |  |
| | Paeoniflorin sulfite Chemical Properties |
| Boiling point | 765.5±70.0 °C(Predicted) | | density | 1.76±0.1 g/cm3(Predicted) | | pka | 1.66±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | VOLJTHZHUMLHDS-HEQFYZJVSA-N | | SMILES | O([C@@]12C[C@@]3([H])[C@@]4(OS(O)=O)C[C@]1(C)O[C@@]([H])([C@@]23COC(=O)C1=CC=CC=C1)O4)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| | Paeoniflorin sulfite Usage And Synthesis |
| Uses | Paeoniflorin, a main component of Paeoniae Radix Alba, could be transformed into Paeoniflorin sulfite during sulfur-fumigation of Paeoniae Radix Alba[1]. | | References | [1] Ke Pei, et al. Ultra-high-performance liquid chromatography-quadrupole/time of flight mass spectrometry combined with statistical analysis for rapidly revealing the influence of sulfur-fumigated Paeoniae Radix Alba on the chemical constituents of Si Wu Tang. Analytical Methods. 2015. |
| | Paeoniflorin sulfite Preparation Products And Raw materials |
|