p-NCS-Bz-DFO manufacturers
|
| | p-NCS-Bz-DFO Basic information |
| Product Name: | p-NCS-Bz-DFO | | Synonyms: | p-NCS-Bz-DFO;2-[1, 4, 7-Triazacyclononan-1-yl-4, 7-bis(tBu-ester)1-1, 5-pentanedioic acid;p-SCN-Bn-Deferoxamine;Butanediamide, N4-[5-[[4-[[5-(acetylhydroxyamino)pentyl]amino]-1,4-dioxobutyl]hydroxyamino]pentyl]-N1-hydroxy-N1-[5-[[[(4-isothiocyanatophenyl)amino]thioxomethyl]amino]pentyl]-;p-SCN-Bn-Deferoxamine,p-NCS-Bz-DFO;p-SCN-Bz-DFO;N1-Hydroxy-N1-(5-(4-(hydroxy(5-(3-(4-isothiocyanatophenyl)thioureido)pentyl)amino)-4-oxobutanamido)pentyl)-N4-(5-(N-hydroxyacetamido)pentyl)succinamide;p-NCS-PTU-DFOB | | CAS: | 1222468-90-7 | | MF: | C33H52N8O8S2 | | MW: | 752.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1222468-90-7.mol |  |
| | p-NCS-Bz-DFO Chemical Properties |
| Melting point | 174° - 175° | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetonitrile (Slightly, Heated), DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | HBAYEVATSBINBX-UHFFFAOYSA-N | | SMILES | C(N(O)CCCCCNC(NC1=CC=C(N=C=S)C=C1)=S)(=O)CCC(NCCCCCN(C(=O)CCC(NCCCCCN(C(C)=O)O)=O)O)=O |
| | p-NCS-Bz-DFO Usage And Synthesis |
| Uses | p-SCN-Bn-deferoxamine, is a bifunctional chelator. | | IC 50 | RDC Linker |
| | p-NCS-Bz-DFO Preparation Products And Raw materials |
|