| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | XC-DAPOL-CPBA (>90%) Basic information |
| Product Name: | XC-DAPOL-CPBA (>90%) | | Synonyms: | XC-DAPOL-CPBA (>90%);5-(N-(3-(4-Boronobenzamido)-2-hydroxypropyl)sulfamoyl)-2-((4-(ethylamino)-3-methylphenyl)(4-(ethylimino)-3-methylcyclohexa-2,5-dien-1-ylidene)methyl)benzenesulfonic acid;Benzenesulfonic acid, 5-[[[3-[(4-boronobenzoyl)amino]-2-hydroxypropyl]amino]sulfonyl]-2-[[4-(ethylamino)-3-methylphenyl][4-(ethylimino)-3-methyl-2,5-cyclohexadien-1-ylidene]methyl]- (9CI);XC-DAPOL-CPBA (>95%);XC-DAPOL-CPBA | | CAS: | 191231-97-7 | | MF: | C35H41BN4O9S2 | | MW: | 736.66 | | EINECS: | | | Product Categories: | chem-chemical | | Mol File: | 191231-97-7.mol |  |
| | XC-DAPOL-CPBA (>90%) Chemical Properties |
| density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | -1.32±0.50(Predicted) | | color | Dark Purple to Very Dark Blue | | Stability: | Hygroscopic | | InChIKey | IPLVPBACMPHHTN-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC(S(NCC(O)CNC(=O)C2=CC=C(B(O)O)C=C2)(=O)=O)=CC=C1C(C1=CC=C(NCC)C(C)=C1)=C1C=CC(=NCC)C(C)=C1 |
| | XC-DAPOL-CPBA (>90%) Usage And Synthesis |
| Uses | XC-DAPOL-CPBA, is a building block that can be used in preparation of glycohemoglobin filter assay based on boronic acid affinity principle. |
| | XC-DAPOL-CPBA (>90%) Preparation Products And Raw materials |
|