| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 6-Triethylammonium-hexanoic acid, 4-amin-TEMPO amide bromide Basic information |
| | 6-Triethylammonium-hexanoic acid, 4-amin-TEMPO amide bromide Chemical Properties |
| Melting point | 216-221°C (decomposition) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C21H42N3O2.BrH/c1-8-24(9-2,10-3)15-13-11-12-14-19(25)22-18-16-20(4,5)23(26)21(6,7)17-18;/h18H,8-17H2,1-7H3;1H | | InChIKey | NEQWUIVYFXHUMV-UHFFFAOYSA-N | | SMILES | [Br-].CC[N+](CC)(CC)CCCCCC(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGIII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 6-Triethylammonium-hexanoic acid, 4-amin-TEMPO amide bromide Usage And Synthesis |
| Uses | A water-soluble thiol specific spin label | | reaction suitability | reagent type: oxidant |
| | 6-Triethylammonium-hexanoic acid, 4-amin-TEMPO amide bromide Preparation Products And Raw materials |
|