|
|
| | JATRORRHIZINE HCL(RG) Basic information |
| Product Name: | JATRORRHIZINE HCL(RG) | | Synonyms: | JATRORRHIZINE HCL(RG);Jatorrhizine, chloride;Jatrochizine chloride;Nsc150445;Neprotine chloride;Jatrorrhizine，Neprotine chloride，Yatrorhizine chloride;Yatrorhizine chloride;Jatrorrhizine hydrochloride, 98%, from Mahonia fortunei (Lindl.) Fedde | | CAS: | 6681-15-8 | | MF: | C20H20NO4.ClH | | MW: | 374.842 | | EINECS: | | | Product Categories: | | | Mol File: | 6681-15-8.mol |  |
| | JATRORRHIZINE HCL(RG) Chemical Properties |
| Melting point | 208-210 °C(Solv: methanol (67-56-1)) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in chloroform and methan | | form | powder | | color | Orange-red | | Stability: | Hygroscopic | | InChI | InChI=1S/C20H19NO4.ClH/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3;/h4-5,8-11H,6-7H2,1-3H3;1H/p+1 | | InChIKey | JKMUUZMCSNHBAX-UHFFFAOYSA-O | | SMILES | C12=CC3=C(C(OC)=C(OC)C=C3)C=[N+]1CCC1C=C(O)C(OC)=CC2=1.Cl |
| | JATRORRHIZINE HCL(RG) Usage And Synthesis |
| Uses | Jaztorrhizine is an alkaloid extract from the Berberidaceae family of plants displaying antioxidant activity. | | in vivo | Jatrorrhizine chloride (intraperitoneal?injection; 5, 10, 20 mg/kg) can significantly reduce the duration of immobility when compared with vehicle control group in tail suspension test (TST)[2]. | Animal Model: | Male ICR albino mice[2] | | Dosage: | 5, 10, 20 mg/kg | | Administration: | Intraperitoneal?injection; 5, 10, 20 mg/kg | | Result: | Reduced immobility period in tail suspension test. |
| | IC 50 | AChE |
| | JATRORRHIZINE HCL(RG) Preparation Products And Raw materials |
|