| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | REVERSIN 205 Basic information |
| Product Name: | REVERSIN 205 | | Synonyms: | REVERSIN 205;[BOC-GLU(OBZL)]2-LYS-OME;L-Lysine, N2,N6-bis[N-[(1,1-dimethylethoxy)carbonyl]-L-α-glutamyl]-, 2-methyl 1,1'-bis(phenylmethyl) ester;Reversin 205 >=98% (HPLC), film | | CAS: | 174630-05-8 | | MF: | C41H58N4O12 | | MW: | 798.92 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | REVERSIN 205 Chemical Properties |
| Melting point | 101-102 °C | | Boiling point | 926.5±65.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO or ethanol: Insoluble in watersoluble | | form | powder | | pka | 11.09±0.46(Predicted) | | color | white | | InChIKey | BRVAQYBFHAIYLQ-CPCREDONSA-N | | SMILES | COC(=O)[C@H](CCCCNC(=O)[C@H](CCC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)NC(=O)[C@H](CCC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | REVERSIN 205 Usage And Synthesis |
| Uses | Reversin 205 has been used to determine the activity of P-glycoprotein in human retinal pigment epithelium. | | General Description | Reversin 205 is a hydrophobic peptide. | | Biochem/physiol Actions | Peptide chemosensitizer, inhibitor of P-glycoprotein. |
| | REVERSIN 205 Preparation Products And Raw materials |
|