|
|
| | 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene Basic information |
| Product Name: | 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene | | Synonyms: | 9,10-BIS(PHENYLETHYNYL)-1,8-DICHLOROANTHRACENE;1,8-DICHLORO-9,10-BIS(PHENYLETHYNYL) ANTHRACENE;1,8-DICHLORO-BPEA;DBEA;1,8-DICHLORO-9,10-BIS(PHENYLETHYNYL) ANTHRACENE 99%;9,10-Bis(phenylethynl)-1,8-dichloroanthracene;1,8-Dichloro-9,10-bis(phenylethynyl)anthracene,99%;Dichloro-9,10-bis(phenylethynyl) a | | CAS: | 51749-83-8 | | MF: | C30H16Cl2 | | MW: | 447.35 | | EINECS: | | | Product Categories: | | | Mol File: | 51749-83-8.mol |  |
| | 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 524.89°C (rough estimate) | | density | 1.0703 (rough estimate) | | refractive index | 1.5610 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C30H16Cl2/c31-27-15-7-13-24-23(19-17-21-9-3-1-4-10-21)25-14-8-16-28(32)30(25)26(29(24)27)20-18-22-11-5-2-6-12-22/h1-16H | | InChIKey | YONGNHJIWAYNLC-UHFFFAOYSA-N | | SMILES | C1(Cl)=C2C(C(C#CC3=CC=CC=C3)=C3C(=C2C#CC2=CC=CC=C2)C(Cl)=CC=C3)=CC=C1 | | CAS DataBase Reference | 51749-83-8 |
| | 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene Usage And Synthesis |
| Chemical Properties | orange powder |
| | 1,8-Dichloro-9,10-bis(phenylethynyl) anthracene Preparation Products And Raw materials |
|