|
|
| | 2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE Basic information |
| Product Name: | 2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE | | Synonyms: | AKOS BB-9904;2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE HYDROCHLORIDE;2,3,4,5-Tetrahydro-1H-3-benzazepine;BENZ-3-AZEPINE;2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE;1H-3-Benzazepine, 2,3,4,5-tetrahydro-;1,2,4,5-Tetrahydro-3H-benzo[d]azepine;1,2,4,5-tetrahydro-3H-3-benzoazepine | | CAS: | 4424-20-8 | | MF: | C10H13N | | MW: | 147.22 | | EINECS: | 807-686-8 | | Product Categories: | | | Mol File: | 4424-20-8.mol | ![2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE Structure](CAS/GIF/4424-20-8.gif) |
| | 2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE Chemical Properties |
| Boiling point | 110-120℃ (11 Torr) | | density | 0.981±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.565 (589.3 nm 20℃) | | Fp | 114.9±14.2℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 10.27±0.20(Predicted) | | form | liquid | | color | Clear, brown | | InChI | InChI=1S/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-4,11H,5-8H2 | | InChIKey | MWVMYAWMFTVYED-UHFFFAOYSA-N | | SMILES | N1CCC2=CC=CC=C2CC1 | | CAS DataBase Reference | 4424-20-8 |
| | 2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE Usage And Synthesis |
| Uses | 5-Azabenzocycloheptene is a reactant used in the synthesis of nonretinoid retinol binding protein 4 antagonists for potential treatment of atrophic age-related macular degeneration and Stargardt disease. |
| | 2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE Preparation Products And Raw materials |
|