| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | L-Aspartic acid-1,2-13C2 Basic information |
| | L-Aspartic acid-1,2-13C2 Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | form | solid | | Optical Rotation | [α]25/D +25.0°, c =2 in 5 M HCl | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i2+1,4+1 | | InChIKey | CKLJMWTZIZZHCS-CJQZVISGSA-N | | SMILES | N[13C@@H](CC(O)=O)[13C](O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Aspartic acid-1,2-13C2 Usage And Synthesis |
| Uses | - High-resolution NMR spectroscopy - Metabolomic profiling and pathway analysis - Stable Isotope probing in Environmental microbiology - Acid-catalyzed reaction mechanism studies |
| | L-Aspartic acid-1,2-13C2 Preparation Products And Raw materials |
|