|
|
| | DMAB-OH Basic information |
| Product Name: | DMAB-OH | | Synonyms: | 2(1(4-HYDROXYME)PHE.AMINO)-3-ME.BUTYLI-;2-{1-[4-(HydroxyMethyl)phenylaMino]-3-Methylbutylidene}-5,5-diMethyl-1,3-cyclohexanedione;DMAB-OH;4-(N-[1-(4,4-DIMETHYL-2,6-DIOXOCYCLOHEXYLIDENE)-3-METHYLBUTYL]-AMINO) BENZYL ALCOHOL;2-(1-((4-(Hydroxymethyl)phenyl)amino)-3-methylbutylidene)-5,5-dimethylcyclohexane-1,3-dione;Dmab-OH Novabiochem;1,3-Cyclohexanedione,2-[1-[[4-(hydroxymethyl)phenyl]amino]-3-methylbutylidene]-5,5-dimethyl-;2-[1-[4-(hydroxymethyl)anilino]-3-methylbutylidene]-5,5-dimethylcyclohexane-1,3-dione | | CAS: | 172611-73-3 | | MF: | C20H27NO3 | | MW: | 329.43 | | EINECS: | | | Product Categories: | | | Mol File: | 172611-73-3.mol |  |
| | DMAB-OH Chemical Properties |
| Melting point | 156-160 | | Boiling point | 482.9±45.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | pka | 14.48±0.10(Predicted) | | form | powder | | Appearance | Light yellow to yellow Solid | | Major Application | peptide synthesis | | InChI | 1S/C20H27NO3/c1-13(2)9-16(21-15-7-5-14(12-22)6-8-15)19-17(23)10-20(3,4)11-18(19)24/h5-8,13,21-22H,9-12H2,1-4H3 | | InChIKey | GARPDGDSXTZYQQ-UHFFFAOYSA-N | | SMILES | N(c2ccc(cc2)CO)C(=C1C(=O)CC(CC1=O)(C)C)CC(C)C |
| WGK Germany | 3 | | HS Code | 2922 50 00 | | Storage Class | 11 - Combustible Solids |
| | DMAB-OH Usage And Synthesis |
| | DMAB-OH Preparation Products And Raw materials |
|