- 3-Thiopheneacetic acid
-
- $1.00 / 1kg
-
2019-07-06
- CAS:6964-21-2
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: as request
|
| | 3-Thiopheneacetic acid Basic information |
| | 3-Thiopheneacetic acid Chemical Properties |
| Melting point | 73-76 °C(lit.) | | Boiling point | 129°C 2,5mm | | density | 1.365 (estimate) | | refractive index | 1.5300 (estimate) | | Fp | 129°C/2.5mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.25±0.10(Predicted) | | form | Crystalline Flakes or Powder | | color | Off-white to beige | | Water Solubility | Very soluble in water. | | BRN | 113622 | | InChI | InChI=1S/C6H6O2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4H,3H2,(H,7,8) | | InChIKey | RCNOGGGBSSVMAS-UHFFFAOYSA-N | | SMILES | C1SC=CC=1CC(O)=O | | CAS DataBase Reference | 6964-21-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Thiopheneacetic acid(6964-21-2) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-24/25-45-36/37/39-27 | | RIDADR | 1759 | | WGK Germany | 3 | | RTECS | XM7570000 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29349990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 3-Thiopheneacetic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3-Thiopheneacetic acid was used in one-step, size control synthesis of gold nanoparticles. It was also used in the preparation of gold nanoparticles capped with 3-thiopheneacetic acid (3-TAA) via borohydride reduction. | | Uses | 3-Thiopheneacetic acid was used in:
- one-step, size control synthesis of gold nanoparticles
- in the preparation of gold nanoparticles capped with 3-thiopheneacetic acid (3-TAA) via borohydride reduction
| | General Description | 3-Thiopheneacetic acid acts as monocarboxylate ligand and forms oxo-carboxylate bridged digadolinium(III) complexes. Electrochemical oxidation of 3-thiopheneacetic acid in dry acetonitrile leads to the formation of a conducting polymeric film of poly (3-thiopheneacetic acid). | | Purification Methods | Crystallise the acid from ligroin or H2O. [Beilstein 18 III/IV 4066.] |
| | 3-Thiopheneacetic acid Preparation Products And Raw materials |
|