4-CHLORO-2,6-DIMETHYLPHENOL manufacturers
- 4-Chloro-2,6-xylenol
-
-
2022-01-15
- CAS:1123-63-3
- Min. Order: 1KG
- Purity: 98.5%
- Supply Ability: 100 tons
|
| | 4-CHLORO-2,6-DIMETHYLPHENOL Basic information |
| Product Name: | 4-CHLORO-2,6-DIMETHYLPHENOL | | Synonyms: | 4-CHLORO-2,6-DIMETHYLPHENOL;4-CHLORO-2,6-XYLENOL;4-Chloro-2,6-xylenol (OH=1);4-Chloro-2,6-dimethylphenol,97%;5-chloro-2-methoxy-1,3-dimethylbenzene;Phenol, 4-chloro-2,6-dimethyl-;4-Chloro-2,6-dimethylphenol-98%;Farnesane Impurity 38 | | CAS: | 1123-63-3 | | MF: | C8H9ClO | | MW: | 156.61 | | EINECS: | 214-376-0 | | Product Categories: | Anisole;Chlorine Compounds;Phenols | | Mol File: | 1123-63-3.mol |  |
| | 4-CHLORO-2,6-DIMETHYLPHENOL Chemical Properties |
| Melting point | 80-85 °C | | Boiling point | 217.76°C (rough estimate) | | density | 1.0950 (rough estimate) | | refractive index | 1.5523 (estimate) | | storage temp. | 2-8°C | | pka | 10.23±0.23(Predicted) | | form | solid | | color | Off white | | Water Solubility | 516.8mg/L(25 ºC) | | BRN | 1908282 | | InChI | InChI=1S/C8H9ClO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 | | InChIKey | VWYKSJIPZHRLNO-UHFFFAOYSA-N | | SMILES | C1(C=C(Cl)C=C(C)C=1O)C | | CAS DataBase Reference | 1123-63-3(CAS DataBase Reference) |
| | 4-CHLORO-2,6-DIMETHYLPHENOL Usage And Synthesis |
| Chemical Properties | white to pale pink fine crystalline needles |
| | 4-CHLORO-2,6-DIMETHYLPHENOL Preparation Products And Raw materials |
| Raw materials | Benzene, 5-chloro-1,3-dimethyl-2-(1-methylethoxy)--->5-chloro-m-xylene-2,alpha,alpha'-triol-->ISOPROPYLMAGNESIUM BROMIDE | | Preparation Products | 4-Chloro-2-methylphenol-->3,4,5-TRICHLOROPHENOL-->2,6-DIMETHYLBENZOQUINONE-->2,6-Dimethylphenol-->Acetonitrile, 2-(4-chloro-2,6-dimethylphenoxy)- |
|