- FMOC-ASP(OTBU)-OPFP
-
- $1.00
-
2019-07-12
- CAS:86061-01-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | FMOC-ASP(OTBU)-OPFP Basic information |
| Product Name: | FMOC-ASP(OTBU)-OPFP | | Synonyms: | N-Fmoc-L-aspartic acid 4-tert-butyl ester pentafluorophenyl ester;(9H-Fluoren-9-yl)MethOxy]Carbonyl Asp(OtBu)-OPfp;N-ALPHA-FMOC-L-ASPARTIC ACID BETA-T-BUTYL ESTER PENTAFLUOROPHENYL ESTER;N-ALPHA-FMOC-L-ASPARTIC ACID BETA-TERT-BUTYL ESTER PENTAFLUOROPHENYL ESTER;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-L-ASPARTIC ACID BETA-T-BUTYL ESTER PENTAFLUORPHENYL ESTER;FMOC-ASPARTIC ACID(OTBU)-OPFP;FMOC-ASP(OBUT)-OPFP;FMOC-ASP(OTBU)-OPFP | | CAS: | 86061-01-0 | | MF: | C29H24F5NO6 | | MW: | 577.5 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Fmoc-Amino acid series;Amino Acids | | Mol File: | 86061-01-0.mol |  |
| | FMOC-ASP(OTBU)-OPFP Chemical Properties |
| Melting point | 90-100°C | | Boiling point | 665.980±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.373±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in water or 1% acetic acid | | form | Powder | | pka | 9.749±0.46(predicted) | | color | White | | Major Application | peptide synthesis | | InChIKey | DWYWJUBBXKYAMY-IBGZPJMESA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)CC(=O)OC(C)(C)C)F)F | | CAS DataBase Reference | 86061-01-0 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-ASP(OTBU)-OPFP Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-ASP(OTBU)-OPFP Preparation Products And Raw materials |
|