| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4,4'-DDMU CAS:1022-22-6 Purity:100 μg/ML in MeOH Package:10Mg
|
|
| | 4,4'-DDMU Basic information |
| | 4,4'-DDMU Chemical Properties |
| Melting point | 68-69 °C | | Boiling point | 365.36°C (rough estimate) | | density | 1.2452 (rough estimate) | | refractive index | 1.5610 (estimate) | | Fp | >100 °C | | storage temp. | 0-6°C | | BRN | 1461623 | | Major Application | agriculture environmental | | InChI | 1S/C14H9Cl3/c15-9-14(10-1-5-12(16)6-2-10)11-3-7-13(17)8-4-11/h1-9H | | InChIKey | LNKQQZFLNUVWQQ-UHFFFAOYSA-N | | SMILES | Cl\C=C(\c1ccc(Cl)cc1)c2ccc(Cl)cc2 | | EPA Substance Registry System | Benzene, 1,1'-(chloroethenylidene)bis(4-chloro- (1022-22-6) |
| Hazard Codes | N,Xi | | Risk Statements | 50/53-41-38 | | Safety Statements | 60-61-39-26 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | RTECS | KU7040000 | | Toxicity | LD50 oral in mouse: 2700mg/kg |
| | 4,4'-DDMU Usage And Synthesis |
| Uses | 4,4''-DDMU | | Definition | ChEBI: A chlorophenylethylene that is chloroethene in which the methylene hydrogens are replaced by 4-chlorophenyl groups. | | Synthesis Reference(s) | Journal of the American Chemical Society, 72, p. 1035, 1950 DOI: 10.1021/ja01158a518 | | Safety Profile | Moderately toxic by ingestion.When heated to decomposition it emits toxic vapors ofCl-. | | Synthesis | In a 500 mL three-necked flask equipped with mechanical stirring, a condenser tube, a dropping funnel, and a temperature-controlled heater, an amount of BTE was added and the temperature was raised to melt it. The catalyst was then added, and at 1
h by dropwise addition of 30% aqueous NaOH solution. After the dropwise addition, the reaction mixture was warmed up to about 110 C, and the reaction was stirred for 6.8
h, and the reaction endpoint was detected by high performance liquid chromatography (HPLC) as the content of unreacted 1,1-bis(chlorophenyl)-2,2,2-trichloroethane was not higher than 1% (area normalization method). At the end of the reaction, the reaction mixture was washed three times with hot water aqueous, the last time with hydrochloric acid to adjust the pH to
7-8. The aqueous phase was separated to give an oily 1,1-bis(chlorophenyl)-2,2-dichloroethylene product. |
| | 4,4'-DDMU Preparation Products And Raw materials |
|