|
|
| | Bisphenol A Bis(2,3-dihydroxypropyl) Ether Basic information |
| Product Name: | Bisphenol A Bis(2,3-dihydroxypropyl) Ether | | Synonyms: | 2,2-BIS[4-(2,3-DIHYDROXYPROPOXY)PHENYL]PROPANE;BISPHENOL A BIS(2,3-DIHYDROXYPROPYL) ETHER;3,3'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bispropane-1,2-diol;BISPHENOLADIGLYCIDYLETHERDIHYDRATE;2,2-BIS(4-(2,3-DIHYDROXYPROPANYL)PHENYL)PROPANE;3,3'-[(1-Methylethylidene)bis(4,1-phenylene)bis(oxy)]bis(1,2-propanediol);3,3'-[(Dimethylmethylene)bis(4,1-phenyleneoxy)]bis(propane-1,2-diol);3,3'-[Dimethylmethylenebis(4,1-phenyleneoxy)]bis(propane-1,2-diol) | | CAS: | 5581-32-8 | | MF: | C21H28O6 | | MW: | 376.44 | | EINECS: | 226-975-4 | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 5581-32-8.mol |  |
| | Bisphenol A Bis(2,3-dihydroxypropyl) Ether Chemical Properties |
| Melting point | 91-97 °C | | Boiling point | 612℃ | | density | 1.224 | | Fp | 324℃ | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetonitrile (Slightly), Methanol (Slightly) | | pka | 13.23±0.20(Predicted) | | color | White to Off-White | | BRN | 2302019 | | Stability: | Hygroscopic | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C21H28O6/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23/h3-10,17-18,22-25H,11-14H2,1-2H3 | | InChIKey | NISVZEWKUNUGQQ-UHFFFAOYSA-N | | SMILES | CC(C)(c1ccc(OCC(O)CO)cc1)c2ccc(OCC(O)CO)cc2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Bisphenol A Bis(2,3-dihydroxypropyl) Ether Usage And Synthesis |
| Uses | Bisphenol A Bis(2,3-dihydroxypropyl) ether is used as a standard for determining toxic monomers released from polymers of the inner coating of cans. |
| | Bisphenol A Bis(2,3-dihydroxypropyl) Ether Preparation Products And Raw materials |
|