|
|
| | (3-Chloro-2-methylphenyl)hydrazine hydrochloride Basic information |
| | (3-Chloro-2-methylphenyl)hydrazine hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C7H9ClN2.ClH/c1-5-6(8)3-2-4-7(5)10-9;/h2-4,10H,9H2,1H3;1H | | InChIKey | NFVOTDWJCRXNTA-UHFFFAOYSA-N | | SMILES | ClC1=C(C)C(NN)=CC=C1.[H]Cl |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2928009090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (3-Chloro-2-methylphenyl)hydrazine hydrochloride Usage And Synthesis |
| | (3-Chloro-2-methylphenyl)hydrazine hydrochloride Preparation Products And Raw materials |
|