|
|
| | 2-Chloro-6-methylpyridine-4-carboxylic acid Basic information |
| | 2-Chloro-6-methylpyridine-4-carboxylic acid Chemical Properties |
| Melting point | 208-212 °C (dec.) (lit.) | | Boiling point | 399.0±37.0 °C(Predicted) | | density | 1.390±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.07±0.10(Predicted) | | color | White to Light yellow | | BRN | 122809 | | InChI | InChI=1S/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11) | | InChIKey | ZGZMEKHQIZSZOH-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC(C(O)=O)=C1 | | CAS DataBase Reference | 25462-85-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-43-20/21/22 | | Safety Statements | 26-36/37/39-22-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-Chloro-6-methylpyridine-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | White solid | | Definition | ChEBI: 2-Chloro-6-methylisonicotinic acid is a member of pyridines and an aromatic carboxylic acid. |
| | 2-Chloro-6-methylpyridine-4-carboxylic acid Preparation Products And Raw materials |
|