| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Indole-d5-3-acetic Acid
CAS:76937-78-5
Remarks:CS-C-02341
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Indole-3-acetic Acid-D5
CAS:76937-78-5
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Artis Biotech Co. Ltd.
|
| Tel: |
19138486554; 18108108965 |
| Email: |
sales@artisbio.com |
| Products Intro: |
Product Name:3-Indolylacetic acid-d5
CAS:76937-78-5
Purity:98% HPLC Package:1mg;5mg;10mg;50mg
|
|
| | INDOLE-2,4,5,6,7-D5-3-ACETIC ACID Basic information |
| | INDOLE-2,4,5,6,7-D5-3-ACETIC ACID Chemical Properties |
| Melting point | 165-169 °C(lit.) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Brown to Dark Brown | | InChI | 1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i1D,2D,3D,4D,6D | | InChIKey | SEOVTRFCIGRIMH-SNOLXCFTSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c(CC(O)=O)c([2H])[nH]c2c1[2H] | | CAS Number Unlabeled | 87-51-4 |
| Safety Statements | 22-24/25 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | INDOLE-2,4,5,6,7-D5-3-ACETIC ACID Usage And Synthesis |
| Uses | Indole-2,4,5,6,7-d5-3-acetic Acid is an isotopic analog of Indoleacetic Acid (I577340) which is the most common and naturally occurring plant hormone in the auxin class of hormones. It effects cell elongation, cell division as well as plant growth and development. |
| | INDOLE-2,4,5,6,7-D5-3-ACETIC ACID Preparation Products And Raw materials |
|