|
|
| | Ethyl N-(diphenylmethylene)glycinate Basic information |
| | Ethyl N-(diphenylmethylene)glycinate Chemical Properties |
| Melting point | 51-53 °C(lit.) | | Boiling point | 195°C/2mmHg(lit.) | | density | 1.0690 (rough estimate) | | refractive index | 1.5400 (estimate) | | Fp | >110°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.22±0.50(Predicted) | | form | Crystalline Powder or Crystals | | color | White to light yellow | | Sensitive | Moisture Sensitive | | λmax | 247nm(Hexane)(lit.) | | BRN | 1979922 | | Stability: | Moisture Sensitive | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C17H17NO2/c1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 | | InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N | | SMILES | CCOC(=O)C\N=C(/c1ccccc1)c2ccccc2 | | LogP | 1.35-3.18 at 25℃ and pH0-14 | | Dissociation constant | 2.3 at 25℃ | | CAS DataBase Reference | 69555-14-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29224999 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1B |
| | Ethyl N-(diphenylmethylene)glycinate Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder or | | Uses | N-(Diphenylmethylene)glycine Ethyl Ester is used as a reagent in the synthesis of pyrazolopyrrolyl tetrahydropyran DPP-4 inhibitors. | | Application |
Ethyl N-(diphenylmethylene)glycinate features a diphenylmethylene group that enhances its reactivity and stability, making it particularly useful in organic synthesis and pharmaceutical development.
| | Reactions |
Ethyl N-(diphenylmethylene)glycinate undergoes monoalkylations, dialkylations and Michael additions to ethylenic and acetylenic acceptors under appropriate solid-liquid phase transfer catalysis conditions. Further transformations of the α-disubstituted ketimines lead to α-alkylated aspartic and glutamic acid derivatives.
| | Synthesis | Ethyl N-(diphenylmethylene)glycinate is prepared by transimination of Benzophenone Imine with alkyl glycinate hydrochloride (room temperature/CH2Cl2). | | References | [1] Patent: EP1422220, 2004, A1. Location in patent: Page 5
[2] Patent: CN104557684, 2017, B. Location in patent: Paragraph 0021-0026; 0027; 0028; 0029; 0030-0033
[3] Tetrahedron Letters, 2005, vol. 46, # 16, p. 2795 - 2797
[4] Patent: US2010/173777, 2010, A1. Location in patent: Page/Page column 23
[5] Patent: WO2016/27285, 2016, A2. Location in patent: Page/Page column 50; 51 |
| | Ethyl N-(diphenylmethylene)glycinate Preparation Products And Raw materials |
|