| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | BOC-[15N]LEU-OH Basic information |
| Product Name: | BOC-[15N]LEU-OH | | Synonyms: | N-ALPHA-T-BUTOXYCARBONYL-[15N]-L-LEUCINE;BOC-[15N]LEUCINE;BOC-[15N]LEU-OH;Boc-Leu-OH-15N monohydrate | | CAS: | 146953-81-3 | | MF: | C11H21NO4 | | MW: | 232.3 | | EINECS: | | | Product Categories: | | | Mol File: | 146953-81-3.mol | ![BOC-[15N]LEU-OH Structure](CAS/GIF/146953-81-3.gif) |
| | BOC-[15N]LEU-OH Chemical Properties |
| Melting point | 85-87°C (lit.) | | storage temp. | -15°C | | form | solid | | Optical Rotation | [α]20/D -25°, c =2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C11H21NO4.H2O/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5;/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1H2/t8-;/m0./s1/i12+1; | | InChIKey | URQQEIOTRWJXBA-SFFPXEBQSA-N | | SMILES | O.CC(C)C[C@H]([15NH]C(=O)OC(C)(C)C)C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | BOC-[15N]LEU-OH Usage And Synthesis |
| | BOC-[15N]LEU-OH Preparation Products And Raw materials |
|