- 3,6-Diaminodurene
-
- $13.00 / 5g
-
2026-04-17
- CAS:3102-87-2
- Min. Order: 5g
- Purity: 0.97
- Supply Ability: 25kg
|
| | 2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE Basic information |
| Product Name: | 2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE | | Synonyms: | DIAMINO DURENE;2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE;1,4-Benzenediamine, 2,3,5,6-tetramethyl-;2,3,5,6-Tetramethyl-1,4-benzenediamine;3,6-DIAMINODUROL;3,6-DIAMINO-1,2,4,5-TETRAMETHYLBENZENE;2,3,5,6-Tetramethyl-para-phenylenediamine;4-AMINO-2,3,5,6-TETRAMETHYLANILINE | | CAS: | 3102-87-2 | | MF: | C10H16N2 | | MW: | 164.25 | | EINECS: | 221-457-4 | | Product Categories: | Medical research;4-mpd whatsapp;pharmaceutical intermediates;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 3102-87-2.mol |  |
| | 2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE Chemical Properties |
| Melting point | 150-155 °C(lit.) | | Boiling point | 281.73°C (rough estimate) | | density | 1.0244 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | pka | 6.11±0.10(Predicted) | | color | White to Light yellow | | BRN | 2208743 | | InChI | InChI=1S/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 | | InChIKey | WCZNKVPCIFMXEQ-UHFFFAOYSA-N | | SMILES | C1(N)=C(C)C(C)=C(N)C(C)=C1C | | CAS DataBase Reference | 3102-87-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-40 | | Safety Statements | 26-36-22 | | WGK Germany | 3 | | RTECS | CZ1599700 | | HS Code | 29215190 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE Usage And Synthesis |
| Chemical Properties | beige fine crystalline powder | | Uses |
2,3,5,6-Tetramethyl-1,4-phenylenediaminev is used in the preparation of polyimide coatings for electronic applications-IC passivation, dielectric for multichip modules, and as a stress relief layer in sensor applications.
|
| | 2,3,5,6-TETRAMETHYL-1,4-PHENYLENEDIAMINE Preparation Products And Raw materials |
|