|
|
| | Fmoc-(S)-3-Amino-3-phenylpropionic acid Basic information |
| | Fmoc-(S)-3-Amino-3-phenylpropionic acid Chemical Properties |
| Melting point | 187.3 °C | | Boiling point | 513.39°C (rough estimate) | | density | 1.2379 (rough estimate) | | refractive index | 1.5614 (estimate) | | storage temp. | 2-8°C | | pka | 4.27±0.10(Predicted) | | form | Powder | | color | White | | BRN | 7982023 | | Major Application | peptide synthesis | | InChI | 1S/C24H21NO4/c26-23(27)14-22(16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1 | | InChIKey | PTSLRPMRTOVHAB-QFIPXVFZSA-N | | SMILES | OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)c4ccccc4 | | CAS DataBase Reference | 209252-15-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-(S)-3-Amino-3-phenylpropionic acid Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-(S)-3-Amino-3-phenylpropionic acid Preparation Products And Raw materials |
|