|
|
| | (R)-1-[3-(Trifluoromethyl)phenyl]ethylamine Basic information |
| Product Name: | (R)-1-[3-(Trifluoromethyl)phenyl]ethylamine | | Synonyms: | (1R)-1-[3-(Trifluoromethyl)phenyl]ethylamine;(R)-1-(3-(trifluoroMethyl)phenyl)ethanaMine-HCl;(R)-1-[3-(TrifluoroMethyl)phenyl]ethylaMine hydrochloride;(R)-1-[3-(Trifluoromethyl)phenyl]ethylamine (R)-α-(m-(trifluoromethyl)phenyl)ethylamine;(R)-1-(3-(trifluoromethyl)phenyl)ethan-1-amine;Benzenemethanamine, a-methyl-3-(trifluoromethyl)-, (aR)-;Benzenemethanamine, α-methyl-3-(trifluoromethyl)-, (αR)-;R-MTF-PEM | | CAS: | 127852-30-6 | | MF: | C9H10F3N | | MW: | 189.18 | | EINECS: | | | Product Categories: | | | Mol File: | 127852-30-6.mol | ![(R)-1-[3-(Trifluoromethyl)phenyl]ethylamine Structure](CAS/GIF/127852-30-6.gif) |
| | (R)-1-[3-(Trifluoromethyl)phenyl]ethylamine Chemical Properties |
| Boiling point | 184.1±35.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.72±0.10(Predicted) | | form | liquid | | color | Clear | | InChI | InChI=1/C9H10F3N/c1-6(13)7-3-2-4-8(5-7)9(10,11)12/h2-6H,13H2,1H3/t6-/s3 | | InChIKey | ODZXRBRYQGYVJY-ISZMHOAENA-N | | SMILES | C1(C(F)(F)F)=CC=CC([C@H](N)C)=C1 |&1:9,r| |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2921490090 |
| | (R)-1-[3-(Trifluoromethyl)phenyl]ethylamine Usage And Synthesis |
| | (R)-1-[3-(Trifluoromethyl)phenyl]ethylamine Preparation Products And Raw materials |
|