|
|
| | L-Aspartic acid (3-13C) Basic information |
| | L-Aspartic acid (3-13C) Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | density | 1.515±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Optical Rotation | [α]25/D +25.0°, c =2 in 5 M HCl | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1+1 | | InChIKey | CKLJMWTZIZZHCS-IJGDANSWSA-N | | SMILES | N[C@@H]([13CH2]C(O)=O)C(O)=O | | CAS Number Unlabeled | 56-84-8 |
| Safety Statements | 22-24/25 | | WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | L-Aspartic acid (3-13C) Usage And Synthesis |
| Uses | L-Aspartic acid-13C-1 is the deuterium labeled L-Aspartic acid[1]. L-Aspartic acid is is an amino acid, shown to be a suitable proagent for colon-specific agent deliverly[2][3]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110
[2] Hosoya K, et al. Blood-brain barrier produces significant efflux of L-aspartic acid but not D-aspartic acid: in vivo evidence using the brain efflux index method. J Neurochem. 1999 Sep;73(3):1206-11. DOI:10.1046/j.1471-4159.1999.0731206.x
[3] Leopold CS, et al. In vivo pharmacokinetic study for the assessment of poly(L-aspartic acid) as a drug carrier for colon-specific drug delivery. J Pharmacokinet Biopharm. 1995 Aug23(4):397-406. DOI:10.1007/BF02353640 |
| | L-Aspartic acid (3-13C) Preparation Products And Raw materials |
|