|
|
| | Chlorodiphenylmethylsilane Basic information | | Uses |
| | Chlorodiphenylmethylsilane Chemical Properties |
| Melting point | -22°C | | Boiling point | 295 °C (lit.) | | density | 1.107 g/mL at 25 °C (lit.) | | vapor pressure | 3 mm Hg ( 125 °C) | | refractive index | n20/D 1.574(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | sol most organic solvents; reacts with protic solvents
such as alcohols, acids, amines, water. | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.128 | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 2937445 | | InChI | 1S/C13H13ClSi/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 | | InChIKey | OJZNZOXALZKPEA-UHFFFAOYSA-N | | SMILES | C[Si](Cl)(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 144-79-6(CAS DataBase Reference) | | NIST Chemistry Reference | Silane, chloromethyldiphenyl-(144-79-6) | | EPA Substance Registry System | Silane, chloromethyldiphenyl- (144-79-6) |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 2987 8/PG 2 | | WGK Germany | 1 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | Chlorodiphenylmethylsilane Usage And Synthesis |
| Uses | Used in the pharmaceutical and chemical industry. | | Chemical Properties | Colorless or yellowish transparent liquid | | Physical properties | bp 295 °C/760 mmHg; d 1.128 g cm?3; n20
D -
1.5742. | | Uses | Methyldiphenylchlorosilane can be used as protecting group for alcohols; reacts with carboxylic acids and
sulfoximes; C-silylates lithium ester enolates. | | Uses | Chloro(methyl)diphenylsilane is used in agrochemical, pharmaceutical and dyestuff field . | | Toxics Screening Level | The ITSL for diphenylmethylchlorosilane has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on an annual averaging time. |
| | Chlorodiphenylmethylsilane Preparation Products And Raw materials |
| Raw materials | 1,1,5,5-Tetraphenyltetramethyltrisiloxane-->Methyltrichlorosilane-->PHENYLMAGNESIUM CHLORIDE | | Preparation Products | hydroxymethyldiphenylsilane-->Disilane,1,1,1,2-tetramethyl-2,2-diphenyl--->TRIPHENYLGERMANIUM CHLORIDE-->1,2-DIMETHYL-1,1,2,2-TETRAPHENYLDISILANE-->DIPHENYLMETHYLSILANE-->DIPHENYLMETHYLETHOXYSILANE |
|