| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:IMazaMethabenz Methyl
CAS:81405-85-8
Purity:100 μg/ML in MeOH Package:1ML
|
|
| | IMAZAMETHABENZ-METHYL Basic information |
| | IMAZAMETHABENZ-METHYL Chemical Properties |
| Melting point | 133℃ | | Fp | 93 °C | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | color | White to Off-White | | Merck | 13,4927 | | BRN | 8328238 | | Henry's Law Constant | 2.6×106 mol/(m3Pa) at 25℃, HSDB (2015) | | Major Application | agriculture
environmental | | InChI | 1S/C16H20N2O3/c1-9(2)16(4)15(20)17-13(18-16)12-8-10(3)6-7-11(12)14(19)21-5/h6-9H,1-5H3,(H,17,18,20) | | InChIKey | FFCCBBNQPIMUJI-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(C)cc1C2=NC(C)(C(C)C)C(=O)N2 | | EPA Substance Registry System | Imazamethabenz-methyl (81405-85-8) |
| WGK Germany | 2 | | RTECS | DG8576140 | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazardous Substances Data | 81405-85-8(Hazardous Substances Data) | | Toxicity | LD50 in rats, rabbits (mg/kg): >5000, 4500 orally, >2000, >2000 dermally (Hedlund, Anderson) |
| | IMAZAMETHABENZ-METHYL Usage And Synthesis |
| Uses | Herbicide. | | Uses | Imazamethabenz-methyl is used in combined herbicides formulations, screening pesticides in foods using gas chromatography and mass spectrometry. |
| | IMAZAMETHABENZ-METHYL Preparation Products And Raw materials |
|