|
|
| | 3-CHLORO-4'-FLUOROPROPIOPHENONE Basic information |
| | 3-CHLORO-4'-FLUOROPROPIOPHENONE Chemical Properties |
| Melting point | 47-49 °C(lit.) | | Boiling point | 100-103°C 3mm | | density | 1.2298 (estimate) | | Fp | 198 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Yellow to Orange | | BRN | 1866785 | | InChI | InChI=1S/C9H8ClFO/c10-6-5-9(12)7-1-3-8(11)4-2-7/h1-4H,5-6H2 | | InChIKey | AAHQPLJUSLMHHR-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)(=O)CCCl | | CAS DataBase Reference | 347-93-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-52/53-22 | | Safety Statements | 37/39-26-61 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-CHLORO-4'-FLUOROPROPIOPHENONE Usage And Synthesis |
| Chemical Properties | LIGHT BROWN TO ORANGE-BROWN CRYSTALLINE POWDER | | Uses | 3-Chloro-4''-fluoropropiophenone can be used as transglutaminase-induced abnormal protein crosslinking inhibitors to prevent and/or use as an therapeutic agent for transglutaminase-related disease. |
| | 3-CHLORO-4'-FLUOROPROPIOPHENONE Preparation Products And Raw materials |
|