- L-Ser-OMe.HCl
-
- $0.00 / 1kg
-
2026-04-03
- CAS:5680-80-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Serine methyl ester hydrochloride Basic information |
| | L-Serine methyl ester hydrochloride Chemical Properties |
| Melting point | 163 °C (dec.)(lit.) | | alpha | 4.5 º (c=2, methanol) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) | | pka | pK1:7.03(+1) (25°C,μ=0.1) | | form | Crystalline Powder or Crystals | | color | White to off-white | | Optical Rotation | [α]20/D +3.4°, c = 4 in methanol | | Water Solubility | soluble | | Sensitive | Moisture Sensitive | | BRN | 3559591 | | Major Application | peptide synthesis | | InChI | InChI=1S/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H/t3-;/m0./s1 | | InChIKey | NDBQJIBNNUJNHA-DFWYDOINSA-N | | SMILES | C(OC)(=O)[C@H](CO)N.[H]Cl | | LogP | -1.261 (est) | | CAS DataBase Reference | 5680-80-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29225000 | | Storage Class | 11 - Combustible Solids |
| | L-Serine methyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | L-Serine Methyl Ester Hydrochloride (cas# 5680-80-8) is a compound useful in organic synthesis. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Serine methyl ester hydrochloride Preparation Products And Raw materials |
|