|
|
| | 1-(4-Aminobenzoyl)-4-methylpiperazine Basic information |
| Product Name: | 1-(4-Aminobenzoyl)-4-methylpiperazine | | Synonyms: | BUTTPARK 19\02-44;(4-Aminophenyl)(4-methylpiperazin-1-yl)methanone;4-[(4-Methyl-1-piperazinyl)carbonyl]aniline;NSC 27588;1-(4-Aminobenzoyl)-4-methyl piperidine;(4-aminophenyl)(4-methyl-1-piperazinyl)Methanone;4-(4-methylpiperazine-1-carbonyl)aniline;Methanone, (4-aminophenyl)(4-methyl-1-piperazinyl)- | | CAS: | 55121-99-8 | | MF: | C12H17N3O | | MW: | 219.28 | | EINECS: | | | Product Categories: | | | Mol File: | 55121-99-8.mol |  |
| | 1-(4-Aminobenzoyl)-4-methylpiperazine Chemical Properties |
| Melting point | 140℃ | | Boiling point | 407.0±40.0 °C(Predicted) | | density | 1.167 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 6.86±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C12H17N3O/c1-14-6-8-15(9-7-14)12(16)10-2-4-11(13)5-3-10/h2-5H,6-9,13H2,1H3 | | InChIKey | WTBSUAXLZLAHPE-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(N)C=C1)(N1CCN(C)CC1)=O |
| | 1-(4-Aminobenzoyl)-4-methylpiperazine Usage And Synthesis |
| Synthesis | Step 3A-2: Synthesis of 4-[(4-methyl-1-piperazinyl)carbonyl]aniline. Pd/C catalyst (150 mg) was added to a methanol solution containing (4-methylpiperazin-1-yl)(4-nitrophenyl)methanone (440 mg, 1.7670 mmol) and the reaction was stirred for 2 h under hydrogen atmosphere. The progress of the reaction was monitored by thin layer chromatography (TLC) (unfolding agent: 10% methanol/chloroform). After completion of the reaction, the mixture was filtered through a bed of diatomaceous earth and the filtrate was concentrated to give 380 mg (98% yield) of 4-[(4-methyl-1-piperazinyl)carbonyl]aniline. | | References | [1] Patent: WO2012/59932, 2012, A1. Location in patent: Page/Page column 121
[2] Bioorganic and Medicinal Chemistry Letters, 2018, vol. 28, # 9, p. 1615 - 1620
[3] Patent: WO2012/58671, 2012, A1. Location in patent: Page/Page column 80
[4] Patent: WO2004/26829, 2004, A2. Location in patent: Page/Page column 96
[5] Chemistry - An Asian Journal, 2017, vol. 12, # 7, p. 785 - 791 |
| | 1-(4-Aminobenzoyl)-4-methylpiperazine Preparation Products And Raw materials |
|