|
|
| | 1H-INDAZOLE-4-CARBOXYLIC ACID Basic information |
| | 1H-INDAZOLE-4-CARBOXYLIC ACID Chemical Properties |
| Melting point | ca 280℃ | | Boiling point | 443.7±18.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 3.35±0.30(Predicted) | | color | White to cream | | InChI | InChI=1S/C8H6N2O2/c11-8(12)5-2-1-3-7-6(5)4-9-10-7/h1-4H,(H,9,10)(H,11,12) | | InChIKey | KGKZHHIUOZGUNP-UHFFFAOYSA-N | | SMILES | N1C2=C(C(C(O)=O)=CC=C2)C=N1 | | CAS DataBase Reference | 677306-38-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1H-INDAZOLE-4-CARBOXYLIC ACID Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of indazole-4-carboxylic acid from 4-bromo-1H-indazole was as follows: sodium hydride (60% dispersed in mineral oil, 1.11 eq.) was added batchwise to an anhydrous tetrahydrofuran (7 L/mol) solution of 4-bromo-1H-indazole (1.00 eq.) at room temperature. The resulting solution was stirred at room temperature for 30 minutes and subsequently cooled to -60°C. A cyclohexane solution of 1.3 M sec-butyl lithium (2.1 eq.) was slowly added while keeping the internal temperature below -50 °C. Stirring of the reaction mixture was continued at -50 °C for 2 hours. Subsequently, a steady stream of anhydrous carbon dioxide gas was passed into the reaction mixture for 1 hour. While maintaining the carbon dioxide gas stream, the reaction mixture was allowed to gradually warm up to room temperature. Brine (6 L/mol) was added and the pH of the mixture was adjusted with concentrated hydrochloric acid to 5. The mixture was extracted with warm ethyl acetate (3 x 8 L/mol), the organic phases were combined, washed with a small amount of brine, dried over anhydrous sodium sulfate and concentrated. Finally, indazole-4-carboxylic acid was purified by silica gel column chromatography or crystallization. | | References | [1] Patent: WO2004/29050, 2004, A1. Location in patent: Page 103;104 |
| | 1H-INDAZOLE-4-CARBOXYLIC ACID Preparation Products And Raw materials |
|