| Company Name: |
Hunan Hui Bai Shi Biotechnology Co., Ltd.
|
| Tel: |
0731-85526065 13308475853 |
| Email: |
ivy@hnhbsj.com |
| Products Intro: |
Product Name:BIOTIN (5-FLUORESCEIN) CONJUGATE CAS:957494-27-8 Purity:90% Package:1g;5g;25g;100g
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Biotin-(5-fluorescein)-conjugate CAS:957494-27-8 Purity:90%+ Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:BIOTIN (5-FLUORESCEIN) CONJUGATE CAS:957494-27-8 Purity:90% Package:200mg Remarks:S53518
|
|
| | BIOTIN (5-FLUORESCEIN) CONJUGATE Basic information |
| Product Name: | BIOTIN (5-FLUORESCEIN) CONJUGATE | | Synonyms: | N-(FLUORESCEIN-5-CARBAMIDOETHYL)BIOTINAMIDE;N-(BIOTINYLAMIDOETHYL)-FLUORESCEIN-5-CARBONAMIDE;BIOTIN (5-FLUORESCEIN) CONJUGATE;N-(Biotinylamidoethyl)-fluorescein-5-carboxamide, N-(Fluorescein-5-carbamidoethyl)biotinamide;N-(Biotinylamidoethyl)-fluorescein-5-carboxamide;Reaxys ID: 20657284;Benzoic acid, 5-[[[2-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]ethyl]amino]carbonyl]-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)-;Sodium (S)-β-hydroxyisobutyrate | | CAS: | 957494-27-8 | | MF: | C33H32N4O8S | | MW: | 644.69 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | BIOTIN (5-FLUORESCEIN) CONJUGATE Chemical Properties |
| Boiling point | 1072.3±65.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | pka | 4.13±0.10(Predicted) | | InChIKey | DFUFXKZUEOKPSD-LFERIPGTSA-N | | SMILES | [H][C@]12CS[C@@H](CCCCC(=O)NCCNC(=O)c3ccc(c(c3)C(O)=O)C4=C5C=CC(=O)C=C5Oc6cc(O)ccc46)[C@@]1([H])NC(=O)N2 |
| WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids |
| | BIOTIN (5-FLUORESCEIN) CONJUGATE Usage And Synthesis |
| Uses | Biotin (5-fluorescein) conjugate is a reagent th at may be used in situations similar to fluorescein isothiocyanate staining to label avidin/streptavidin conjugated molecules such as antibodies with the fluorophore 5-fluorescein. |
| | BIOTIN (5-FLUORESCEIN) CONJUGATE Preparation Products And Raw materials |
|