4-Bromo-1,1,2-trifluoro-1-butene manufacturers
|
| | 4-Bromo-1,1,2-trifluoro-1-butene Basic information |
| Product Name: | 4-Bromo-1,1,2-trifluoro-1-butene | | Synonyms: | 4-Bromo-1,1,2-trifluorobutene.;4-Bromo-1,1,2-trifluorobut-1-ene 98%;4-Bromo-1,1,2-trifluorobut-1-ene98%;TIMTEC-BB SBB006604;1-Butene, 4-bromo-1,1,2-trifluoro-;1-Bromo-3,4,4-trifluoro-3-butene;3,4,4-Trifluoro-1-bromo-3-butene;1,1,2-Trifluoro-4-bromo-1-butene | | CAS: | 10493-44-4 | | MF: | C4H4BrF3 | | MW: | 188.97 | | EINECS: | 234-019-2 | | Product Categories: | Organic Building Blocks;Alkenyl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Alkenyl;Halogenated Hydrocarbons | | Mol File: | 10493-44-4.mol |  |
| | 4-Bromo-1,1,2-trifluoro-1-butene Chemical Properties |
| Boiling point | 95-98 °C (lit.) | | density | 1.639 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.401(lit.) | | Fp | 63 °F | | storage temp. | Flammables area | | form | liquid | | color | Clear, faint lime | | Water Solubility | Not miscible or difficult to mix in water. | | Sensitive | Light Sensitive | | BRN | 1840755 | | InChI | InChI=1S/C4H4BrF3/c5-2-1-3(6)4(7)8/h1-2H2 | | InChIKey | GQCQMFYIFUDARF-UHFFFAOYSA-N | | SMILES | C(/F)(\F)=C(/F)\CCBr | | CAS DataBase Reference | 10493-44-4(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Bromo-1,1,2-trifluorobutene-1(10493-44-4) |
| Hazard Codes | F,Xi | | Risk Statements | 11-20/21/22-36/37-36/37/38 | | Safety Statements | 16-26-36-37/39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Highly Flammable/Irritant | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29037990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 4-Bromo-1,1,2-trifluoro-1-butene Usage And Synthesis |
| Chemical Properties | clear colorless to brown-yellow liquid | | Uses | 4-Bromo-1,1,2-trifluoro-1-butene is used in organic synthesis, chemical research and pharmaceuticals. | | Uses | 4-Bromo-1,1,2-trifluoro-1-butene may be used in the preparation of 1,1,2-trifluoro-1-butene, via reaction with KOH in the presence of phase-transfer catalyst, tetrabutylammonium bromide. | | General Description | 4-Bromo-1,1,2-trifluoro-1-butene is a fluorinated building block. It reacts with potassium hydroxide in the presence of tetrabutylammonium bromide (a phase transfer catalyst) to afford 1,1,2-trifluoro-1,3-butadiene. |
| | 4-Bromo-1,1,2-trifluoro-1-butene Preparation Products And Raw materials |
|