|
|
| | 2-Methylnicotinic acid Basic information |
| | 2-Methylnicotinic acid Chemical Properties |
| Melting point | 228-230 °C (dec.)(lit.) | | Boiling point | 280.4±20.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder or Crystalline | | pka | 1.95±0.10(Predicted) | | color | Off-white to light brown | | BRN | 114333 | | InChI | InChI=1S/C7H7NO2/c1-5-6(7(9)10)3-2-4-8-5/h2-4H,1H3,(H,9,10) | | InChIKey | HNTZKNJGAFJMHQ-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC=C1C(O)=O | | CAS DataBase Reference | 3222-56-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Methylnicotinic acid Usage And Synthesis |
| Chemical Properties | Off-white Plates | | Uses | Nicotinic acid (NN429250) derivative. | | Uses | 2-Methylpyridine-3-carboxylic acid was used in synthesis of 1,8-dioxo-1,2,7,8-tetrahydro-2,7,10-triaza-anthracene-4,5-dicarbaldehydes (DOTTADs) and their imines. It was also used in synthesis of 7,7-dichloro-5,7-dihydro-thieno[3,4-b]pyridin-5-one. |
| | 2-Methylnicotinic acid Preparation Products And Raw materials |
|