- Fmoc-L-Asp(Obzl)-OH
-
- $0.00 / 1kg
-
2026-01-23
- CAS:86060-84-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | Fmoc-L-aspartic acid 4-benzyl ester Basic information |
| | Fmoc-L-aspartic acid 4-benzyl ester Chemical Properties |
| Melting point | 120-130 °C | | alpha | -20 º (c=1% in DMF) | | Boiling point | 687.2±55.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in methanol. | | pka | 3.54±0.23(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 20.0±2°, c = 1% in DMF | | BRN | 4609615 | | Major Application | peptide synthesis | | InChIKey | OQGAELAJEGGNKG-QHCPKHFHSA-N | | SMILES | OC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 86060-84-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-aspartic acid 4-benzyl ester Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Used as pharmaceutical intermediates. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-aspartic acid 4-benzyl ester Preparation Products And Raw materials |
|