|
|
| | 1,2,4-Trifluorobenzene Basic information |
| Product Name: | 1,2,4-Trifluorobenzene | | Synonyms: | 1,2,4-TRIFLUOROBENZENE;1,3,4-Trifluorobenzene;Benzene, 1,2,4-trifluoro-;1,2,4-TrifL;3-(2-cyclohexylideneethyl)-4-hydroxynaphthalene-1,2-dione;Trifluorobenzene2;1,2,4-Trifluorobenzene, 97+%;1,2,4-Trifluorobenzene,98+% | | CAS: | 367-23-7 | | MF: | C6H3F3 | | MW: | 132.08 | | EINECS: | 206-684-9 | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Fluorobenzene;Aromatic Hydrocarbons (substituted) & Derivatives;Miscellaneous;Aryl;Halogenated Hydrocarbons;Fluorine series;bc0001;C6 | | Mol File: | 367-23-7.mol |  |
| | 1,2,4-Trifluorobenzene Chemical Properties |
| Boiling point | 88 °C/759 mmHg (lit.) | | density | 1.264 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | 40 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly) | | form | clear liquid | | Specific Gravity | 1.264 | | color | Colorless to Light yellow | | BRN | 2042865 | | InChI | InChI=1S/C6H3F3/c7-4-1-2-5(8)6(9)3-4/h1-3H | | InChIKey | PEBWOGPSYUIOBP-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(F)C=C1F | | CAS DataBase Reference | 367-23-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2,4-Trifluorobenzene(367-23-7) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36-7-33-29-7/9 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,4-Trifluorobenzene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,2,4-Trifluorobenzene can be used as composite membranes with improved performance and durability. | | General Description | Infrared absorption spectrum of liquid 1,2,4-trifluorobenzene has been investigated using LiF, NaCl, KBr and KRS-5 prisms. The microwave spectrum of 1,2,4-trifluorobenzene has been investigated at dry ice temperature in the frequency range of 8 to 12.4GHz. |
| | 1,2,4-Trifluorobenzene Preparation Products And Raw materials |
| Raw materials | 1,4-Cyclohexadiene, 3,3,6,6-tetrafluoro--->2,5-Difluorophenol-->1,4-Difluorobenzene | | Preparation Products | 2,4,5-Trifluorobenzoic acid-->2,3,6-TRIFLUOROBENZOIC ACID-->2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE-->2,5-Difluorobenzoic acid-->1,2,4,5-Tetrafluorobenzene-->2,4,5-Trifluorophenylacetic acid |
|