|
|
| | 1,4-Bis(diphenylphosphino)butane Basic information |
| | 1,4-Bis(diphenylphosphino)butane Chemical Properties |
| Melting point | 132-136 °C (lit.) | | Boiling point | 542.0±33.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White to almost white | | Water Solubility | Soluble in chloroform. Slightly soluble in water | | BRN | 706446 | | InChI | InChI=1S/C28H28P2/c1-5-15-25(16-6-1)29(26-17-7-2-8-18-26)23-13-14-24-30(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22H,13-14,23-24H2 | | InChIKey | BCJVBDBJSMFBRW-UHFFFAOYSA-N | | SMILES | P(CCCCP(C1C=CC=CC=1)C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 | | CAS DataBase Reference | 7688-25-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Bis(diphenylphosphino)butane(7688-25-7) | | EPA Substance Registry System | Phosphine, 1,4-butanediylbis[diphenyl- (7688-25-7) |
| | 1,4-Bis(diphenylphosphino)butane Usage And Synthesis |
| Chemical Properties | 1,4-Bis(diphenylphosphino)butane is a white solid that is soluble in organic solvents.
| | Uses | 1,4-Bis(diphenylphosphino)butane is used in Suzuki reaction. It plays an essential role as a ligand in palladium(0)-catalyzed acylcyanation of arylacetylenes and deprotection of allyloxycarbamates. It acts as a ligand for alkylations, isomerization reactions and in organometallic chemistry. Further, it is used in Heck reaction, Negishi coupling and Sonogashira coupling. In addition to this, it is useful in organometallic chemistry. | | reaction suitability | reagent type: ligand reaction type: Alkylations reagent type: ligand reaction type: Heck Reaction reagent type: ligand reaction type: Isomerizations reagent type: ligand reaction type: Negishi Coupling reagent type: ligand reaction type: Sonogashira Coupling reagent type: ligand reaction type: Stille Coupling reagent type: ligand reaction type: Suzuki-Miyaura Coupling | | storage | Readily oxidized in solution to the phosphine oxide and should be handled under N2 or Ar. The compound is air-stable in the solid state.
| | Purification Methods | Recrystallise it from EtOH [Trippett J Chem Soc 4263 1961]. [King J Coord Chem 1 62 1971, Tolman Chem Rev 77 313 1977.] |
| | 1,4-Bis(diphenylphosphino)butane Preparation Products And Raw materials |
| Raw materials | Ethanol-->Sodium hydroxide-->Hydrochloric acid-->Ethyl acetate-->Tetrahydrofuran-->Dichloromethane-->Sodium-->Magnesium sulfate-->Acetone-->n-Butyllithium-->Triphenylphosphine-->Lithium-->Diphenylphosphine-->1,4-Dibromobutane-->1,4-Dichlorobutane-->Diphenyl[4-(diphenylphosphinyl)butyl]phosphine oxide | | Preparation Products | (S)-(-)-7,7'-BIS[DI(3,5-DIMETHYLPHENYL)PHOSPHINO]-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE-->(R)-7,7'-BIS(DIPHENYLPHOSPHINO)-1,1'-SPIROBIINDANE-->(R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE-->(S)-7,7'-Bis[di(p-methylphenyl)phosphino]-1,1'-spirobiindane ,97%-->(R)-(+)-7,7'-BIS[DI(4-METHYLPHENYL)PHOSPHINO]-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE-->(4-chlorobutyl)diphenylphosphane-->TETRAPHENYLBIPHOSPHINE |
|