3-Dimethylaminomethyl-benzylamine manufacturers
|
| | 3-Dimethylaminomethyl-benzylamine Basic information |
| Product Name: | 3-Dimethylaminomethyl-benzylamine | | Synonyms: | [3-(aminomethyl)benzyl]dimethylamine dihydrochloride;MFCD10586465;1,3-Benzenedimethanamine, N1,N1-dimethyl-;CHEMBRDG-BB 4014714;N-[3-(AMINOMETHYL)BENZYL]-N,N-DIMETHYLAMINE;1-[3-(AMINOMETHYL)PHENYL]-N,N-DIMETHYLMETHANAMINE;1-[3-(aminomethyl)phenyl]-N,N-dimethylmethanamine(SALTDATA: 2HCl);N-[3-(Aminomethyl)benzyl]-n,n-dimethylamine DiHCl | | CAS: | 246258-97-9 | | MF: | C10H16N2 | | MW: | 164.25 | | EINECS: | | | Product Categories: | | | Mol File: | 246258-97-9.mol |  |
| | 3-Dimethylaminomethyl-benzylamine Chemical Properties |
| form | solid | | InChI | 1S/C10H16N2.2ClH/c1-12(2)8-10-5-3-4-9(6-10)7-11;;/h3-6H,7-8,11H2,1-2H3;2*1H | | InChIKey | DWAXNQMEKXYZJE-UHFFFAOYSA-N | | SMILES | NCC1=CC=CC(CN(C)C)=C1.Cl.Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 |
| | 3-Dimethylaminomethyl-benzylamine Usage And Synthesis |
| | 3-Dimethylaminomethyl-benzylamine Preparation Products And Raw materials |
|