|
|
| | 3-(METHYLSULFONYL)BENZOIC ACID Basic information |
| | 3-(METHYLSULFONYL)BENZOIC ACID Chemical Properties |
| Melting point | 230-238 °C | | Boiling point | 230-238°C | | density | 1.4787 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | pK1:3.52 (25°C) | | color | White to very slightly yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C8H8O4S/c1-13(11,12)7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H,9,10) | | InChIKey | KUTBMATZUQWFSR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(S(C)(=O)=O)=C1 | | CAS DataBase Reference | 5345-27-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 24/25-39-26 | | Hazard Note | Irritant | | HS Code | 29163990 |
| | 3-(METHYLSULFONYL)BENZOIC ACID Usage And Synthesis |
| Chemical Properties | White to very slightly yellow powder | | Uses | 3-(methylsulfonyl)benzoic acid is important organic synthesis intermediate, there is larger using value in producer faces such as dyestuff, medicine and agricultural chemicals.Especially in agriculture Prescription face, is the important intermediate for synthesizing mesotrione. |
| | 3-(METHYLSULFONYL)BENZOIC ACID Preparation Products And Raw materials |
|