|
|
| | Methyl 4-phenylthiophene-2-carboxylate Basic information |
| Product Name: | Methyl 4-phenylthiophene-2-carboxylate | | Synonyms: | BUTTPARK 46\15-23;RARECHEM AL BF 0924;JR-9054, Methyl 4-phenylthiophene-2-carboxylate, 97%;2-Thiophenecarboxylic acid, 4-phenyl-, methyl ester;4-Phenylthiophene-2-carboxylic acid methyl ester;Methyl 4-phenylthiophene-2-carboxylate | | CAS: | 21676-90-4 | | MF: | C12H10O2S | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 21676-90-4.mol |  |
| | Methyl 4-phenylthiophene-2-carboxylate Chemical Properties |
| Melting point | 96-98°C | | form | solid | | InChI | 1S/C12H10O2S/c1-14-12(13)11-7-10(8-15-11)9-5-3-2-4-6-9/h2-8H,1H3 | | InChIKey | MVHSKIOLDZOPEF-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=CC(C2=CC=CC=C2)=CS1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4-phenylthiophene-2-carboxylate Usage And Synthesis |
| | Methyl 4-phenylthiophene-2-carboxylate Preparation Products And Raw materials |
|