|
|
| | Phenyltrimethylammonium bromide Basic information |
| Product Name: | Phenyltrimethylammonium bromide | | Synonyms: | TRIMETHYLPHENYLAMMONIUM BROMIDE;N,N,N-TriMethylbenzenaMiniuM broMide;BenzenaMiniuM,N,N,N-triMethyl-, broMide (1:1);N-Phenyl-N,N,N-trimethylammonium bromide;n,n,n-trimethylphenylammonium bromide;Ammonium trimethylphenyl bromide.;BENZENAMINIUM,N,N,N-TRIMETHYL-,BROMIDE;Ammonium, phenyltrimethyl bromide | | CAS: | 16056-11-4 | | MF: | C9H14BrN | | MW: | 216.12 | | EINECS: | 240-202-8 | | Product Categories: | Ammonium Bromides (Quaternary);Quaternary Ammonium Compounds | | Mol File: | 16056-11-4.mol |  |
| | Phenyltrimethylammonium bromide Chemical Properties |
| Melting point | 215 °C (dec.) (lit.) | | density | 1.2 | | refractive index | 1.5870 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | almost transparency in Water | | form | powder to crystal | | color | White to Almost white | | Sensitive | Hygroscopic | | BRN | 3917006 | | InChI | InChI=1S/C9H14N.BrH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1 | | InChIKey | GNMJFQWRASXXMS-UHFFFAOYSA-M | | SMILES | C1([N+](C)(C)C)=CC=CC=C1.[Br-] | | CAS DataBase Reference | 16056-11-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenaminium, N,N,N-trimethyl-, bromide (16056-11-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | BT2100000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intravenous,4mg/kg (4mg/kg),LUNGS, THORAX, OR RESPIRATION: RESPIRATORY DEPRESSION,Journal of Pharmacology and Experimental Therapeutics. Vol. 99, Pg. 16, 1950. |
| | Phenyltrimethylammonium bromide Usage And Synthesis |
| Chemical Properties | white to blue crystalline powder or chunks | | Uses | Trimethylphenylammonium bromide is a quaternary ammonium salt consisting of a positively charged N,N,N-trimethylanilinium cation and a negatively charged bromide anion. This compound is commonly used as a phase transfer catalyst in organic chemical reactions, facilitating the transfer of reactants between immiscible phases. It can also be used as a reagent in the synthesis of various organic compounds and in some applications as a surfactant or corrosion inhibitor. |
| | Phenyltrimethylammonium bromide Preparation Products And Raw materials |
|