- Propisochlor
-
- $0.00 / 25kg
-
2025-12-02
- CAS:86763-47-5
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
|
| | Propisochlor Basic information |
| Product Name: | Propisochlor | | Synonyms: | 2-Chloro-N-(2-ethyl-6-methylphenyl)-N-(isopropoxymethyl)acetamide;2-CHLORO-2'-ETHYL-6'-METHYL-N-(ISOPROPOXYMETHYL)ACETANILIDE;PROPONIT;PROPISOCHLOR;propisochlor (bsii,pa e-iso);propisochlore ((m) pa f-iso);Proponit, 2-Chloro-2μ-ethyl-6μ-methyl-N-(isopropoxymethyl)acetanilide;Propisochlor 5 | | CAS: | 86763-47-5 | | MF: | C15H22ClNO2 | | MW: | 283.79 | | EINECS: | | | Product Categories: | | | Mol File: | 86763-47-5.mol |  |
| | Propisochlor Chemical Properties |
| Melting point | 21.6 °C | | Boiling point | >243 °C | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform, Ethyl Acetate (Slightly) | | pka | 1.30±0.50(Predicted) | | color | Dark Yellow | | Major Application | agriculture
environmental | | InChI | 1S/C15H22ClNO2/c1-5-13-8-6-7-12(4)15(13)17(14(18)9-16)10-19-11(2)3/h6-8,11H,5,9-10H2,1-4H3 | | InChIKey | KZNDFYDURHAESM-UHFFFAOYSA-N | | SMILES | CCc1cccc(C)c1N(COC(C)C)C(=O)CCl | | LogP | 3.500 | | CAS DataBase Reference | 86763-47-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 21 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal |
| | Propisochlor Usage And Synthesis |
| Uses | Propisochlor is an herbicide that is absorbed through the shoots of germinating plants. |
| | Propisochlor Preparation Products And Raw materials |
|