| Company Name: |
Jinan Junhe Pharmaceutical Co., Ltd Gold
|
| Tel: |
13475558980 13475558980 |
| Email: |
644535754@qq.com |
| Products Intro: |
Product Name:(4-PROPOXY-PHENYL)-ACETIC ACID CAS:26118-57-0 Purity:99% Package:1kg;25kg;100kg
|
|
| | (4-Propoxy-phenyl)-acetic acid Basic information |
| | (4-Propoxy-phenyl)-acetic acid Chemical Properties |
| Melting point | 82-84 °C | | Boiling point | 331.6±17.0 °C(Predicted) | | density | 1.116±0.06 g/cm3(Predicted) | | pka | 4.45±0.10(Predicted) | | InChI | InChI=1S/C11H14O3/c1-2-7-14-10-5-3-9(4-6-10)8-11(12)13/h3-6H,2,7-8H2,1H3,(H,12,13) | | InChIKey | ULLCOWORODEDBK-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(OCCC)C=C1 |
| HazardClass | IRRITANT | | HS Code | 2918999090 |
| | (4-Propoxy-phenyl)-acetic acid Usage And Synthesis |
| Uses | (4-Propoxyphenyl)acetic Acid can be used as p38α inhibitor for lung cancer. |
| | (4-Propoxy-phenyl)-acetic acid Preparation Products And Raw materials |
|