|
|
| | 4'-CHLORO-4-BIPHENYLBORONIC ACID Basic information |
| Product Name: | 4'-CHLORO-4-BIPHENYLBORONIC ACID | | Synonyms: | 4'-CHLORO-4-BIPHENYLBORONIC ACID;AKOS BRN-1036;4'-chlorobiphenyl-4-ylboronic
acid;(4'-Chloro-[1,1'-biphenyl]-4-yl)boronic acid;4'-Chloro-biphenyl-4-boronic acid;4'-Chloro-4-biphenylboronic acid 98%;(4'-Chloro-[1,1'-biphenyl]-4-yl)boronic Acid (contains varying amounts of Anhydride);4'- Chlorobenzene-4-boronic acid | | CAS: | 364044-44-0 | | MF: | C12H10BClO2 | | MW: | 232.47 | | EINECS: | | | Product Categories: | | | Mol File: | 364044-44-0.mol |  |
| | 4'-CHLORO-4-BIPHENYLBORONIC ACID Chemical Properties |
| Boiling point | 411.0±47.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 8.52±0.17(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H10BClO2/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16/h1-8,15-16H | | InChIKey | FVKZNRXWZCBUPY-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C2=CC=C(Cl)C=C2)C=C1)(O)O |
| | 4'-CHLORO-4-BIPHENYLBORONIC ACID Usage And Synthesis |
| Uses | 4''-Chloro-4-biphenylboronic acid |
| | 4'-CHLORO-4-BIPHENYLBORONIC ACID Preparation Products And Raw materials |
|