|
|
| | 5-Bromo-3-fluoro-pyridine-2-carbonitrile Basic information | | Uses |
| Product Name: | 5-Bromo-3-fluoro-pyridine-2-carbonitrile | | Synonyms: | 5-bromo-3-fluoropicolinonitrile;5--3-·ú-2-áà¤×;5-BroMo-2-cyano-3-fluorop...;5-BroMo-2-cyano-3-fluoropyridine;5-Bromo-2-cyano-3-fluoropyridine, 5-Bromo-3-fluoropicolinonitrile;5-BROMO-3-FLUORO-PYRIDINE-2-CARBONITRILE;2-Pyridinecarbonitrile, 5-bromo-3-fluoro-;5-BroMo-3-fluoro-2-pyridinecarbonitrile | | CAS: | 886373-28-0 | | MF: | C6H2BrFN2 | | MW: | 201 | | EINECS: | 688-366-3 | | Product Categories: | Heterocyclic Building Blocks | | Mol File: | Mol File |  |
| | 5-Bromo-3-fluoro-pyridine-2-carbonitrile Chemical Properties |
| Melting point | 103-105℃ | | Boiling point | 238.0±35.0℃ (760 Torr) | | density | 1.81±0.1 g/cm3 (20 ºC 760 Torr) | | Fp | 97.7±25.9℃ | | storage temp. | -20°C | | pka | -5.10±0.20(Predicted) | | form | solid | | color | Yellow | | InChI | InChI=1S/C6H2BrFN2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H | | InChIKey | HMURQOFNWZWERT-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(Br)C=C1F |
| Hazard Codes | Xn | | Risk Statements | 22-38-41 | | Safety Statements | 26-39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Bromo-3-fluoro-pyridine-2-carbonitrile Usage And Synthesis |
| Uses | 5-Bromo-3-fluoro-2-pyridinecarboxylonite is an off-white to pale yellow solid, commonly used as an intermediate in organic synthesis. | | Synthesis | 5-Bromo-3-fluoro-2-pyridinecarbonitrile is an off-white to pale yellow solid, commonly used as an intermediate in organic synthesis, such as the synthesis of 5-bromo-3-methoxypyridine-2-carbonitrile
| | References | [1] Patent: US2012/165338, 2012, A1. Location in patent: Page/Page column 22 [2] Patent: WO2012/89601, 2012, A1. Location in patent: Page/Page column 54 [3] Patent: WO2012/66070, 2012, A1. Location in patent: Page/Page column 96-97 [4] Patent: WO2005/63690, 2005, A1. Location in patent: Page/Page column 29 [5] Patent: WO2009/36996, 2009, A2. Location in patent: Page/Page column 105 |
| | 5-Bromo-3-fluoro-pyridine-2-carbonitrile Preparation Products And Raw materials |
|