|
|
| | Loratadine ketone Basic information |
| Product Name: | Loratadine ketone | | Synonyms: | (1-METHYL-4-PIPERIDINYL) {3[2-(3-CHLOROPHENYL) ETHYL ]2-PYRIDINYL} METHANONE =98%;(3-(3-chlorophenethyl)pyridin-2-yl)(1-Methylpiperidin-4-yl)Methanone;1-(METHYL-4-PIPERIDINYL) [3(2)-(3-CHLOROPHENYL) ETHYL 2-PYRIDINYL] METHANONE;loratadine ketone;{3-[2-(3-Chlorophenyl)-Ethyl]-2-Pyridinyl}-(1-Methyl-4-Piperidinyl)-Methanone;(1-Methyl-4-Piperidinyl) [3-[2-(3-Chlorophenyl)Ethyl]-2-Pyridinyl]Methanone HCl;{3-[2-(3-CHLORO-PHENYL)-ETHYL]-PYRIDIN-2-YL}-(1-METHYL-PIPERIDIN-4-YL)-METHANONE;Methanone, [3-[2-(3-chlorophenyl)ethyl]-2-pyridinyl](1-methyl-4-piperidinyl)- | | CAS: | 130642-50-1 | | MF: | C20H23ClN2O | | MW: | 342.86 | | EINECS: | | | Product Categories: | | | Mol File: | 130642-50-1.mol |  |
| | Loratadine ketone Chemical Properties |
| Melting point | 179-186°C | | Boiling point | 462.0±45.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | pka | 8.18±0.10(Predicted) | | InChI | InChI=1S/C20H23ClN2O/c1-23-12-9-17(10-13-23)20(24)19-16(5-3-11-22-19)8-7-15-4-2-6-18(21)14-15/h2-6,11,14,17H,7-10,12-13H2,1H3 | | InChIKey | YBWTYYOASANXND-UHFFFAOYSA-N | | SMILES | C(C1=NC=CC=C1CCC1=CC=CC(Cl)=C1)(C1CCN(C)CC1)=O | | CAS DataBase Reference | 130642-50-1(CAS DataBase Reference) |
| | Loratadine ketone Usage And Synthesis |
| Uses | [3-[2-(3-Chlorophenyl)ethyl]-2-pyridinyl](1-methyl-4-piperidinyl)methanone is an impurity of Loratadine (L469575), a nonsedating-type histamine H1-receptor. |
| | Loratadine ketone Preparation Products And Raw materials |
|