3,3-dimethoxycyclobutanecarboxamide manufacturers
|
| | 3,3-dimethoxycyclobutanecarboxamide Basic information |
| Product Name: | 3,3-dimethoxycyclobutanecarboxamide | | Synonyms: | 3,3-dimethoxycyclobutanecarboxamide;Cyclobutanecarboxamide, 3,3-dimethoxy-;3,3-dimethoxycyclobutane-1-formamide;3,3-dimethoxycyclobutanecarboxamide - [D85643];3,3-Dimethoxycyclobutane-1-methylAmide | | CAS: | 2360931-42-4 | | MF: | C7H13NO3 | | MW: | 159.18 | | EINECS: | | | Product Categories: | | | Mol File: | 2360931-42-4.mol |  |
| | 3,3-dimethoxycyclobutanecarboxamide Chemical Properties |
| Boiling point | 285.6±40.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | pka | 16.43±0.40(Predicted) | | InChI | InChI=1S/C7H13NO3/c1-10-7(11-2)3-5(4-7)6(8)9/h5H,3-4H2,1-2H3,(H2,8,9) | | InChIKey | DHHVXSMXSNLXLD-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)CC(OC)(OC)C1 |
| | 3,3-dimethoxycyclobutanecarboxamide Usage And Synthesis |
| | 3,3-dimethoxycyclobutanecarboxamide Preparation Products And Raw materials |
|