| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Butt Park Ltd. |
| Tel: |
44 (1761)-435170 |
| Email: |
113707.50@compuserve.com |
|
| | BUTTPARK 10\01-33 Basic information |
| Product Name: | BUTTPARK 10\01-33 | | Synonyms: | BUTTPARK 10\01-33;4-hydroxy-8-(trifluoromethyl)-3-quinolinecarbohydrazide | | CAS: | | | MF: | | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![BUTTPARK 10\01-33 Structure]() |
| | BUTTPARK 10\01-33 Chemical Properties |
| form | solid | | InChI | 1S/C11H8F3N3O2/c12-11(13,14)7-3-1-2-5-8(7)16-4-6(9(5)18)10(19)17-15/h1-4H,15H2,(H,16,18)(H,17,19) | | InChIKey | OETNJGVZOBKJOR-UHFFFAOYSA-N | | SMILES | NNC(=O)c1cnc2c(cccc2c1O)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | BUTTPARK 10\01-33 Usage And Synthesis |
| | BUTTPARK 10\01-33 Preparation Products And Raw materials |
|