- 8-BROMO-2-CHLOROQUINOLINE
-
- $9.80 / 1.79999995231628KG
-
2019-12-26
- CAS:163485-86-7
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | 8-BROMO-2-CHLOROQUINOLINE Basic information |
| Product Name: | 8-BROMO-2-CHLOROQUINOLINE | | Synonyms: | 8-BROMO-2-CHLOROQUINOLINE;8-Bromo-2-chloroquinoline 98%;Quinoline, 8-bromo-2-chloro-;8-Bromo-2-Chloroquinoline8-Bromo-2-Chloroquinoline;4-N,N-Dimethylcarbamoyloxy-benzoic acid | | CAS: | 163485-86-7 | | MF: | C9H5BrClN | | MW: | 242.5 | | EINECS: | | | Product Categories: | | | Mol File: | 163485-86-7.mol |  |
| | 8-BROMO-2-CHLOROQUINOLINE Chemical Properties |
| Melting point | 113-114 °C(Solv: methanol (67-56-1)) | | Boiling point | 325.7±22.0 °C(Predicted) | | density | 1.673 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -2.33±0.50(Predicted) | | color | Light brown | | InChI | InChI=1S/C9H5BrClN/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H | | InChIKey | ZXSUGMMMZOMZTD-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2Br)C=CC=1Cl |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids |
| | 8-BROMO-2-CHLOROQUINOLINE Usage And Synthesis |
| Uses |
8-Bromo-2-chloroquinoline is a quinoline derivative and can be used in organic and pharmaceutical synthesis.
| | Hazard |
8-Bromo-2-chloroquinoline has oral acute toxicity and serious eye damage/eye irritation.
|
| | 8-BROMO-2-CHLOROQUINOLINE Preparation Products And Raw materials |
|