|
|
| | Methanone, [1-[(4-fluorophenyl)methyl]-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- Basic information |
| | Methanone, [1-[(4-fluorophenyl)methyl]-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- Chemical Properties |
| Boiling point | 484.3±30.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.3 mg/ml; DMSO: 25 mg/ml; Ethanol: 10 mg/ml | | form | A crystalline solid | | SMILES | O=C(C1C(C)(C)C1(C)C)C2=CN(CC3=CC=C(F)C=C3)C4=CC=CC=C42 |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 | | DEA Controlled Substances | CSCN: 7014 CSA SCH: Schedule I NARC: No |
| | Methanone, [1-[(4-fluorophenyl)methyl]-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- Usage And Synthesis |
| Uses | FUB-144 is a derivative of XLR11 (X746300), which is an aminoalkylindole compound that is expected to be a cannabinoid (CB) mimetic. The biological and toxicological properties of this compound have not been evaluated. This product is intended for forensic and research applications. FUB-144 is a synthetic cannabinoid. Synthetic cannabinoids |
| | Methanone, [1-[(4-fluorophenyl)methyl]-1H-indol-3-yl](2,2,3,3-tetramethylcyclopropyl)- Preparation Products And Raw materials |
|